C10H16O6 — CID 118797968
(2R,3R,4S,5S,6R)-2-but-3-ynoxy-6-(hydroxymethyl)oxane-3,4,5-triol (PubChem CID 118797968) has the molecular formula C10H16O6 and a molecular weight of 232.23 g/mol. Its IUPAC name is (2R,3R,4S,5S,6R)-2-but-3-ynoxy-6-(hydroxymethyl)oxane-3,4,5-triol.
| Compound Name | (2R,3R,4S,5S,6R)-2-but-3-ynoxy-6-(hydroxymethyl)oxane-3,4,5-triol |
|---|---|
| PubChem CID | 118797968 |
| Molecular Formula | C10H16O6 |
| Molecular Weight | 232.23 g/mol |
| Exact Mass | 232.09 |
| IUPAC Name | (2R,3R,4S,5S,6R)-2-but-3-ynoxy-6-(hydroxymethyl)oxane-3,4,5-triol |
| SMILES | C#CCCO[C@@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C10H16O6/c1-2-3-4-15-10-9(14)8(13)7(12)6(5-11)16-10/h1,6-14H,3-5H2/t6-,7-,8+,9-,10-/m1/s1 |
| InChIKey | LYCIVKHZSWRECA-HOTMZDKISA-N |
| XLogP | -2.17 |
| TPSA | 99.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.23 |
| LogP ≤ 5 | -2.17 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|