About (7-methylpyrrolo[2,3-d]pyrimidin-4-yl)methanol
(7-methylpyrrolo[2,3-d]pyrimidin-4-yl)methanol (PubChem CID 118798143) has the molecular formula C8H9N3O
and a molecular weight of 163.18 g/mol. Its IUPAC name is (7-methylpyrrolo[2,3-d]pyrimidin-4-yl)methanol.
Molecular Properties
| Compound Name | (7-methylpyrrolo[2,3-d]pyrimidin-4-yl)methanol |
| PubChem CID | 118798143 |
| Molecular Formula | C8H9N3O |
| Molecular Weight | 163.18 g/mol |
| Exact Mass | 163.07 |
| IUPAC Name | (7-methylpyrrolo[2,3-d]pyrimidin-4-yl)methanol |
| SMILES | Cn1ccc2c(CO)ncnc21 |
| InChI | InChI=1S/C8H9N3O/c1-11-3-2-6-7(4-12)9-5-10-8(6)11/h2-3,5,12H,4H2,1H3 |
| InChIKey | AVERXDJETHETQV-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 163.18 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (7-methylpyrrolo[2,3-d]pyrimidin-4-yl)methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (7-methylpyrrolo[2,3-d]pyrimidin-4-yl)methanol?
The IUPAC name of (7-methylpyrrolo[2,3-d]pyrimidin-4-yl)methanol (CID 118798143) is (7-methylpyrrolo[2,3-d]pyrimidin-4-yl)methanol.
What is the SMILES notation for (7-methylpyrrolo[2,3-d]pyrimidin-4-yl)methanol?
The canonical SMILES for (7-methylpyrrolo[2,3-d]pyrimidin-4-yl)methanol is Cn1ccc2c(CO)ncnc21.
What is the InChIKey of (7-methylpyrrolo[2,3-d]pyrimidin-4-yl)methanol?
The InChIKey is AVERXDJETHETQV-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9N3O/c1-11-3-2-6-7(4-12)9-5-10-8(6)11/h2-3,5,12H,4H2,1H3.
What are the key properties of (7-methylpyrrolo[2,3-d]pyrimidin-4-yl)methanol?
(7-methylpyrrolo[2,3-d]pyrimidin-4-yl)methanol has a molecular weight of 163.18 g/mol, XLogP of 0.46, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (7-methylpyrrolo[2,3-d]pyrimidin-4-yl)methanol is sourced from PubChem (CID 118798143), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).