C12H20N2O3 — CID 118798288
tert-butyl (4aS,8aR)-2,3,4,4a,5,8a-hexahydropyrido[4,3-b][1,4]oxazine-6-carboxylate (PubChem CID 118798288) has the molecular formula C12H20N2O3 and a molecular weight of 240.30 g/mol. Its IUPAC name is tert-butyl (4aS,8aR)-2,3,4,4a,5,8a-hexahydropyrido[4,3-b][1,4]oxazine-6-carboxylate.
| Compound Name | tert-butyl (4aS,8aR)-2,3,4,4a,5,8a-hexahydropyrido[4,3-b][1,4]oxazine-6-carboxylate |
|---|---|
| PubChem CID | 118798288 |
| Molecular Formula | C12H20N2O3 |
| Molecular Weight | 240.30 g/mol |
| Exact Mass | 240.15 |
| IUPAC Name | tert-butyl (4aS,8aR)-2,3,4,4a,5,8a-hexahydropyrido[4,3-b][1,4]oxazine-6-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1C=C[C@H]2OCCN[C@H]2C1 |
| InChI | InChI=1S/C12H20N2O3/c1-12(2,3)17-11(15)14-6-4-10-9(8-14)13-5-7-16-10/h4,6,9-10,13H,5,7-8H2,1-3H3/t9-,10+/m0/s1 |
| InChIKey | NJXNNOISNPGFDO-VHSXEESVSA-N |
| XLogP | 1.11 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.30 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |