About 2-aminobutane-1,4-diol;hydrochloride
2-aminobutane-1,4-diol;hydrochloride (PubChem CID 118798335) has the molecular formula C4H12ClNO2
and a molecular weight of 141.60 g/mol. Its IUPAC name is 2-aminobutane-1,4-diol;hydrochloride.
Molecular Properties
| Compound Name | 2-aminobutane-1,4-diol;hydrochloride |
| PubChem CID | 118798335 |
| Molecular Formula | C4H12ClNO2 |
| Molecular Weight | 141.60 g/mol |
| Exact Mass | 141.06 |
| IUPAC Name | 2-aminobutane-1,4-diol;hydrochloride |
| SMILES | Cl.NC(CO)CCO |
| InChI | InChI=1S/C4H11NO2.ClH/c5-4(3-7)1-2-6;/h4,6-7H,1-3,5H2;1H |
| InChIKey | MDAFQSSEKNVPOI-UHFFFAOYSA-N |
| XLogP | -0.89 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 141.60 |
| LogP ≤ 5 | -0.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-aminobutane-1,4-diol;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-aminobutane-1,4-diol;hydrochloride?
The IUPAC name of 2-aminobutane-1,4-diol;hydrochloride (CID 118798335) is 2-aminobutane-1,4-diol;hydrochloride.
What is the SMILES notation for 2-aminobutane-1,4-diol;hydrochloride?
The canonical SMILES for 2-aminobutane-1,4-diol;hydrochloride is Cl.NC(CO)CCO.
What is the InChIKey of 2-aminobutane-1,4-diol;hydrochloride?
The InChIKey is MDAFQSSEKNVPOI-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H11NO2.ClH/c5-4(3-7)1-2-6;/h4,6-7H,1-3,5H2;1H.
What are the key properties of 2-aminobutane-1,4-diol;hydrochloride?
2-aminobutane-1,4-diol;hydrochloride has a molecular weight of 141.60 g/mol, XLogP of -0.89, 3 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-aminobutane-1,4-diol;hydrochloride is sourced from PubChem (CID 118798335), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).