About [(2S,4S)-4-methylpyrrolidin-2-yl]methanol;hydrochloride
[(2S,4S)-4-methylpyrrolidin-2-yl]methanol;hydrochloride (PubChem CID 118798391) has the molecular formula C6H14ClNO
and a molecular weight of 151.64 g/mol. Its IUPAC name is [(2S,4S)-4-methylpyrrolidin-2-yl]methanol;hydrochloride.
Molecular Properties
| Compound Name | [(2S,4S)-4-methylpyrrolidin-2-yl]methanol;hydrochloride |
| PubChem CID | 118798391 |
| Molecular Formula | C6H14ClNO |
| Molecular Weight | 151.64 g/mol |
| Exact Mass | 151.08 |
| IUPAC Name | [(2S,4S)-4-methylpyrrolidin-2-yl]methanol;hydrochloride |
| SMILES | C[C@@H]1CN[C@H](CO)C1.Cl |
| InChI | InChI=1S/C6H13NO.ClH/c1-5-2-6(4-8)7-3-5;/h5-8H,2-4H2,1H3;1H/t5-,6-;/m0./s1 |
| InChIKey | XQUDEODBOXKGJB-GEMLJDPKSA-N |
| XLogP | 0.40 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 151.64 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze [(2S,4S)-4-methylpyrrolidin-2-yl]methanol;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2S,4S)-4-methylpyrrolidin-2-yl]methanol;hydrochloride?
The IUPAC name of [(2S,4S)-4-methylpyrrolidin-2-yl]methanol;hydrochloride (CID 118798391) is [(2S,4S)-4-methylpyrrolidin-2-yl]methanol;hydrochloride.
What is the SMILES notation for [(2S,4S)-4-methylpyrrolidin-2-yl]methanol;hydrochloride?
The canonical SMILES for [(2S,4S)-4-methylpyrrolidin-2-yl]methanol;hydrochloride is C[C@@H]1CN[C@H](CO)C1.Cl.
What is the InChIKey of [(2S,4S)-4-methylpyrrolidin-2-yl]methanol;hydrochloride?
The InChIKey is XQUDEODBOXKGJB-GEMLJDPKSA-N. The full InChI is InChI=1S/C6H13NO.ClH/c1-5-2-6(4-8)7-3-5;/h5-8H,2-4H2,1H3;1H/t5-,6-;/m0./s1.
What are the key properties of [(2S,4S)-4-methylpyrrolidin-2-yl]methanol;hydrochloride?
[(2S,4S)-4-methylpyrrolidin-2-yl]methanol;hydrochloride has a molecular weight of 151.64 g/mol, XLogP of 0.40, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [(2S,4S)-4-methylpyrrolidin-2-yl]methanol;hydrochloride is sourced from PubChem (CID 118798391), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).