C15H28N2O5 — CID 118798500
ditert-butyl 6-hydroxy-1,4-diazepane-1,4-dicarboxylate (PubChem CID 118798500) has the molecular formula C15H28N2O5 and a molecular weight of 316.40 g/mol. Its IUPAC name is ditert-butyl 6-hydroxy-1,4-diazepane-1,4-dicarboxylate.
| Compound Name | ditert-butyl 6-hydroxy-1,4-diazepane-1,4-dicarboxylate |
|---|---|
| PubChem CID | 118798500 |
| Molecular Formula | C15H28N2O5 |
| Molecular Weight | 316.40 g/mol |
| Exact Mass | 316.20 |
| IUPAC Name | ditert-butyl 6-hydroxy-1,4-diazepane-1,4-dicarboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCN(C(=O)OC(C)(C)C)CC(O)C1 |
| InChI | InChI=1S/C15H28N2O5/c1-14(2,3)21-12(19)16-7-8-17(10-11(18)9-16)13(20)22-15(4,5)6/h11,18H,7-10H2,1-6H3 |
| InChIKey | CNXHKECPYYPLBF-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 79.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.40 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |