C11H9ClN2O — CID 118799025
8-chloro-2,3,9,9a-tetrahydropyrido[3,4-b]indol-1-one (PubChem CID 118799025) has the molecular formula C11H9ClN2O and a molecular weight of 220.66 g/mol. Its IUPAC name is 8-chloro-2,3,9,9a-tetrahydropyrido[3,4-b]indol-1-one.
| Compound Name | 8-chloro-2,3,9,9a-tetrahydropyrido[3,4-b]indol-1-one |
|---|---|
| PubChem CID | 118799025 |
| Molecular Formula | C11H9ClN2O |
| Molecular Weight | 220.66 g/mol |
| Exact Mass | 220.04 |
| IUPAC Name | 8-chloro-2,3,9,9a-tetrahydropyrido[3,4-b]indol-1-one |
| SMILES | O=C1NCC=C2c3cccc(Cl)c3NC12 |
| InChI | InChI=1S/C11H9ClN2O/c12-8-3-1-2-6-7-4-5-13-11(15)10(7)14-9(6)8/h1-4,10,14H,5H2,(H,13,15) |
| InChIKey | SXQXFBWPESOCKS-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.66 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |