C8H6BrF2NO3 — CID 118800091
2-[4-bromo-6-(difluoromethyl)-5-hydroxy-2-pyridinyl]acetic acid (PubChem CID 118800091) has the molecular formula C8H6BrF2NO3 and a molecular weight of 282.04 g/mol. Its IUPAC name is 2-[4-bromo-6-(difluoromethyl)-5-hydroxy-2-pyridinyl]acetic acid.
| Compound Name | 2-[4-bromo-6-(difluoromethyl)-5-hydroxy-2-pyridinyl]acetic acid |
|---|---|
| PubChem CID | 118800091 |
| Molecular Formula | C8H6BrF2NO3 |
| Molecular Weight | 282.04 g/mol |
| Exact Mass | 280.95 |
| IUPAC Name | 2-[4-bromo-6-(difluoromethyl)-5-hydroxy-2-pyridinyl]acetic acid |
| SMILES | O=C(O)Cc1cc(Br)c(O)c(C(F)F)n1 |
| InChI | InChI=1S/C8H6BrF2NO3/c9-4-1-3(2-5(13)14)12-6(7(4)15)8(10)11/h1,8,15H,2H2,(H,13,14) |
| InChIKey | GTJOGEJEDSAECV-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 70.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.04 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |