C8H5F4NO4 — CID 118800466
4-(fluoromethyl)-6-oxo-2-(trifluoromethoxy)-1H-pyridine-3-carboxylic acid (PubChem CID 118800466) has the molecular formula C8H5F4NO4 and a molecular weight of 255.12 g/mol. Its IUPAC name is 4-(fluoromethyl)-6-oxo-2-(trifluoromethoxy)-1H-pyridine-3-carboxylic acid.
| Compound Name | 4-(fluoromethyl)-6-oxo-2-(trifluoromethoxy)-1H-pyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 118800466 |
| Molecular Formula | C8H5F4NO4 |
| Molecular Weight | 255.12 g/mol |
| Exact Mass | 255.02 |
| IUPAC Name | 4-(fluoromethyl)-6-oxo-2-(trifluoromethoxy)-1H-pyridine-3-carboxylic acid |
| SMILES | O=C(O)c1c(CF)cc(=O)[nH]c1OC(F)(F)F |
| InChI | InChI=1S/C8H5F4NO4/c9-2-3-1-4(14)13-6(5(3)7(15)16)17-8(10,11)12/h1H,2H2,(H,13,14)(H,15,16) |
| InChIKey | XGYSEGXXFDGKDL-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 79.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.12 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |