C26H32N4O8 — CID 11880089
(1S,3S,4R,5R)-3-[(4-acetylphenyl)carbamoylamino]-N-[(2S)-1-amino-3-(4-methoxyphenyl)-1-oxopropan-2-yl]-1,4,5-trihydroxycyclohexane-1-carboxamide (PubChem CID 11880089) has the molecular formula C26H32N4O8 and a molecular weight of 528.56 g/mol. Its IUPAC name is (1S,3S,4R,5R)-3-[(4-acetylphenyl)carbamoylamino]-N-[(2S)-1-amino-3-(4-methoxyphenyl)-1-oxopropan-2-yl]-1,4,5-trihydroxycyclohexane-1-carboxamide.
| Compound Name | (1S,3S,4R,5R)-3-[(4-acetylphenyl)carbamoylamino]-N-[(2S)-1-amino-3-(4-methoxyphenyl)-1-oxopropan-2-yl]-1,4,5-trihydroxycyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 11880089 |
| Molecular Formula | C26H32N4O8 |
| Molecular Weight | 528.56 g/mol |
| Exact Mass | 528.22 |
| IUPAC Name | (1S,3S,4R,5R)-3-[(4-acetylphenyl)carbamoylamino]-N-[(2S)-1-amino-3-(4-methoxyphenyl)-1-oxopropan-2-yl]-1,4,5-trihydroxycyclohexane-1-carboxamide |
| SMILES | COc1ccc(C[C@H](NC(=O)[C@@]2(O)C[C@@H](O)[C@H](O)[C@@H](NC(=O)Nc3ccc(C(C)=O)cc3)C2)C(N)=O)cc1 |
| InChI | InChI=1S/C26H32N4O8/c1-14(31)16-5-7-17(8-6-16)28-25(36)30-20-12-26(37,13-21(32)22(20)33)24(35)29-19(23(27)34)11-15-3-9-18(38-2)10-4-15/h3-10,19-22,32-33,37H,11-13H2,1-2H3,(H2,27,34)(H,29,35)(H2,28,30,36)/t19-,20-,21+,22+,26-/m0/s1 |
| InChIKey | OVAYEHUEEHWTIR-JUHADAAFSA-N |
| XLogP | -0.15 |
| TPSA | 200.31 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.56 |
| LogP ≤ 5 | -0.15 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 8 |