C10H8F2N4 — CID 118803246
6-(aminomethyl)-5-(cyanomethyl)-2-(difluoromethyl)pyridine-3-carbonitrile (PubChem CID 118803246) has the molecular formula C10H8F2N4 and a molecular weight of 222.20 g/mol. Its IUPAC name is 6-(aminomethyl)-5-(cyanomethyl)-2-(difluoromethyl)pyridine-3-carbonitrile.
| Compound Name | 6-(aminomethyl)-5-(cyanomethyl)-2-(difluoromethyl)pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 118803246 |
| Molecular Formula | C10H8F2N4 |
| Molecular Weight | 222.20 g/mol |
| Exact Mass | 222.07 |
| IUPAC Name | 6-(aminomethyl)-5-(cyanomethyl)-2-(difluoromethyl)pyridine-3-carbonitrile |
| SMILES | N#CCc1cc(C#N)c(C(F)F)nc1CN |
| InChI | InChI=1S/C10H8F2N4/c11-10(12)9-7(4-14)3-6(1-2-13)8(5-15)16-9/h3,10H,1,5,15H2 |
| InChIKey | HMVVXCSVJXUWEU-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 86.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.20 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |