C15H13ClF3NO — CID 118807452
2-chloro-N,N-dimethyl-4-[2-(trifluoromethoxy)phenyl]aniline (PubChem CID 118807452) has the molecular formula C15H13ClF3NO and a molecular weight of 315.72 g/mol. Its IUPAC name is 2-chloro-N,N-dimethyl-4-[2-(trifluoromethoxy)phenyl]aniline.
| Compound Name | 2-chloro-N,N-dimethyl-4-[2-(trifluoromethoxy)phenyl]aniline |
|---|---|
| PubChem CID | 118807452 |
| Molecular Formula | C15H13ClF3NO |
| Molecular Weight | 315.72 g/mol |
| Exact Mass | 315.06 |
| IUPAC Name | 2-chloro-N,N-dimethyl-4-[2-(trifluoromethoxy)phenyl]aniline |
| SMILES | CN(C)c1ccc(-c2ccccc2OC(F)(F)F)cc1Cl |
| InChI | InChI=1S/C15H13ClF3NO/c1-20(2)13-8-7-10(9-12(13)16)11-5-3-4-6-14(11)21-15(17,18)19/h3-9H,1-2H3 |
| InChIKey | AIRDCRDCBVJCFV-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.72 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |