About 2-(2,4,5-trichlorophenyl)-5-(trifluoromethyl)pyridine-4-carboxylic acid
2-(2,4,5-trichlorophenyl)-5-(trifluoromethyl)pyridine-4-carboxylic acid (PubChem CID 118808083) has the molecular formula C13H5Cl3F3NO2
and a molecular weight of 370.54 g/mol. Its IUPAC name is 2-(2,4,5-trichlorophenyl)-5-(trifluoromethyl)pyridine-4-carboxylic acid.
Molecular Properties
| Compound Name | 2-(2,4,5-trichlorophenyl)-5-(trifluoromethyl)pyridine-4-carboxylic acid |
| PubChem CID | 118808083 |
| Molecular Formula | C13H5Cl3F3NO2 |
| Molecular Weight | 370.54 g/mol |
| Exact Mass | 368.93 |
| IUPAC Name | 2-(2,4,5-trichlorophenyl)-5-(trifluoromethyl)pyridine-4-carboxylic acid |
| SMILES | O=C(O)c1cc(-c2cc(Cl)c(Cl)cc2Cl)ncc1C(F)(F)F |
| InChI | InChI=1S/C13H5Cl3F3NO2/c14-8-3-10(16)9(15)1-6(8)11-2-5(12(21)22)7(4-20-11)13(17,18)19/h1-4H,(H,21,22) |
| InChIKey | SCSSKNSBTVKEDE-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 370.54 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|
Analyze 2-(2,4,5-trichlorophenyl)-5-(trifluoromethyl)pyridine-4-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2,4,5-trichlorophenyl)-5-(trifluoromethyl)pyridine-4-carboxylic acid?
The IUPAC name of 2-(2,4,5-trichlorophenyl)-5-(trifluoromethyl)pyridine-4-carboxylic acid (CID 118808083) is 2-(2,4,5-trichlorophenyl)-5-(trifluoromethyl)pyridine-4-carboxylic acid.
What is the SMILES notation for 2-(2,4,5-trichlorophenyl)-5-(trifluoromethyl)pyridine-4-carboxylic acid?
The canonical SMILES for 2-(2,4,5-trichlorophenyl)-5-(trifluoromethyl)pyridine-4-carboxylic acid is O=C(O)c1cc(-c2cc(Cl)c(Cl)cc2Cl)ncc1C(F)(F)F.
What is the InChIKey of 2-(2,4,5-trichlorophenyl)-5-(trifluoromethyl)pyridine-4-carboxylic acid?
The InChIKey is SCSSKNSBTVKEDE-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H5Cl3F3NO2/c14-8-3-10(16)9(15)1-6(8)11-2-5(12(21)22)7(4-20-11)13(17,18)19/h1-4H,(H,21,22).
What are the key properties of 2-(2,4,5-trichlorophenyl)-5-(trifluoromethyl)pyridine-4-carboxylic acid?
2-(2,4,5-trichlorophenyl)-5-(trifluoromethyl)pyridine-4-carboxylic acid has a molecular weight of 370.54 g/mol, XLogP of 5.43, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2,4,5-trichlorophenyl)-5-(trifluoromethyl)pyridine-4-carboxylic acid is sourced from PubChem (CID 118808083), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).