C7H4BrF3N2O4 — CID 118810096
2-(bromomethyl)-6-nitro-3-(trifluoromethoxy)-1H-pyridin-4-one (PubChem CID 118810096) has the molecular formula C7H4BrF3N2O4 and a molecular weight of 317.02 g/mol. Its IUPAC name is 2-(bromomethyl)-6-nitro-3-(trifluoromethoxy)-1H-pyridin-4-one.
| Compound Name | 2-(bromomethyl)-6-nitro-3-(trifluoromethoxy)-1H-pyridin-4-one |
|---|---|
| PubChem CID | 118810096 |
| Molecular Formula | C7H4BrF3N2O4 |
| Molecular Weight | 317.02 g/mol |
| Exact Mass | 315.93 |
| IUPAC Name | 2-(bromomethyl)-6-nitro-3-(trifluoromethoxy)-1H-pyridin-4-one |
| SMILES | O=c1cc([N+](=O)[O-])[nH]c(CBr)c1OC(F)(F)F |
| InChI | InChI=1S/C7H4BrF3N2O4/c8-2-3-6(17-7(9,10)11)4(14)1-5(12-3)13(15)16/h1H,2H2,(H,12,14) |
| InChIKey | MKBMYIMHRZPCHN-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 85.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.02 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|