About 4-chloro-6-(difluoromethyl)-2,3-difluoropyridine
4-chloro-6-(difluoromethyl)-2,3-difluoropyridine (PubChem CID 118811179) has the molecular formula C6H2ClF4N
and a molecular weight of 199.53 g/mol. Its IUPAC name is 4-chloro-6-(difluoromethyl)-2,3-difluoropyridine.
Molecular Properties
| Compound Name | 4-chloro-6-(difluoromethyl)-2,3-difluoropyridine |
| PubChem CID | 118811179 |
| Molecular Formula | C6H2ClF4N |
| Molecular Weight | 199.53 g/mol |
| Exact Mass | 198.98 |
| IUPAC Name | 4-chloro-6-(difluoromethyl)-2,3-difluoropyridine |
| SMILES | Fc1nc(C(F)F)cc(Cl)c1F |
| InChI | InChI=1S/C6H2ClF4N/c7-2-1-3(5(9)10)12-6(11)4(2)8/h1,5H |
| InChIKey | FXSQSSGLOXZTNL-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 199.53 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 4-chloro-6-(difluoromethyl)-2,3-difluoropyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-chloro-6-(difluoromethyl)-2,3-difluoropyridine?
The IUPAC name of 4-chloro-6-(difluoromethyl)-2,3-difluoropyridine (CID 118811179) is 4-chloro-6-(difluoromethyl)-2,3-difluoropyridine.
What is the SMILES notation for 4-chloro-6-(difluoromethyl)-2,3-difluoropyridine?
The canonical SMILES for 4-chloro-6-(difluoromethyl)-2,3-difluoropyridine is Fc1nc(C(F)F)cc(Cl)c1F.
What is the InChIKey of 4-chloro-6-(difluoromethyl)-2,3-difluoropyridine?
The InChIKey is FXSQSSGLOXZTNL-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H2ClF4N/c7-2-1-3(5(9)10)12-6(11)4(2)8/h1,5H.
What are the key properties of 4-chloro-6-(difluoromethyl)-2,3-difluoropyridine?
4-chloro-6-(difluoromethyl)-2,3-difluoropyridine has a molecular weight of 199.53 g/mol, XLogP of 2.95, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-chloro-6-(difluoromethyl)-2,3-difluoropyridine is sourced from PubChem (CID 118811179), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).