C8H4BrF3INO3 — CID 118811704
2-[4-bromo-5-iodo-6-(trifluoromethoxy)-3-pyridinyl]acetic acid (PubChem CID 118811704) has the molecular formula C8H4BrF3INO3 and a molecular weight of 425.93 g/mol. Its IUPAC name is 2-[4-bromo-5-iodo-6-(trifluoromethoxy)-3-pyridinyl]acetic acid.
| Compound Name | 2-[4-bromo-5-iodo-6-(trifluoromethoxy)-3-pyridinyl]acetic acid |
|---|---|
| PubChem CID | 118811704 |
| Molecular Formula | C8H4BrF3INO3 |
| Molecular Weight | 425.93 g/mol |
| Exact Mass | 424.84 |
| IUPAC Name | 2-[4-bromo-5-iodo-6-(trifluoromethoxy)-3-pyridinyl]acetic acid |
| SMILES | O=C(O)Cc1cnc(OC(F)(F)F)c(I)c1Br |
| InChI | InChI=1S/C8H4BrF3INO3/c9-5-3(1-4(15)16)2-14-7(6(5)13)17-8(10,11)12/h2H,1H2,(H,15,16) |
| InChIKey | NHTXVCJBDLXGTJ-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 59.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.93 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|