C26H38N2O — CID 11881181
(5S,8R,9R,10S,13S,14R,16Z)-16-[(1-ethyl-3-methylpyrazol-4-yl)methylidene]-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15-dodecahydro-1H-cyclopenta[a]phenanthren-17-one (PubChem CID 11881181) has the molecular formula C26H38N2O and a molecular weight of 394.60 g/mol. Its IUPAC name is (5S,8R,9R,10S,13S,14R,16Z)-16-[(1-ethyl-3-methylpyrazol-4-yl)methylidene]-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15-dodecahydro-1H-cyclopenta[a]phenanthren-17-one.
| Compound Name | (5S,8R,9R,10S,13S,14R,16Z)-16-[(1-ethyl-3-methylpyrazol-4-yl)methylidene]-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15-dodecahydro-1H-cyclopenta[a]phenanthren-17-one |
|---|---|
| PubChem CID | 11881181 |
| Molecular Formula | C26H38N2O |
| Molecular Weight | 394.60 g/mol |
| Exact Mass | 394.30 |
| IUPAC Name | (5S,8R,9R,10S,13S,14R,16Z)-16-[(1-ethyl-3-methylpyrazol-4-yl)methylidene]-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15-dodecahydro-1H-cyclopenta[a]phenanthren-17-one |
| SMILES | CCn1cc(/C=C2/C[C@@H]3[C@@H]4CC[C@@H]5CCCC[C@]5(C)[C@@H]4CC[C@]3(C)C2=O)c(C)n1 |
| InChI | InChI=1S/C26H38N2O/c1-5-28-16-19(17(2)27-28)14-18-15-23-21-10-9-20-8-6-7-12-25(20,3)22(21)11-13-26(23,4)24(18)29/h14,16,20-23H,5-13,15H2,1-4H3/b18-14-/t20-,21+,22+,23+,25-,26-/m0/s1 |
| InChIKey | RVYRVPOBLIJZMR-XUWXEKTNSA-N |
| XLogP | 6.21 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.60 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|