C6H4F4N2 — CID 118812171
2-(difluoromethyl)-3,5-difluoropyridin-4-amine (PubChem CID 118812171) has the molecular formula C6H4F4N2 and a molecular weight of 180.10 g/mol. Its IUPAC name is 2-(difluoromethyl)-3,5-difluoropyridin-4-amine.
| Compound Name | 2-(difluoromethyl)-3,5-difluoropyridin-4-amine |
|---|---|
| PubChem CID | 118812171 |
| Molecular Formula | C6H4F4N2 |
| Molecular Weight | 180.10 g/mol |
| Exact Mass | 180.03 |
| IUPAC Name | 2-(difluoromethyl)-3,5-difluoropyridin-4-amine |
| SMILES | Nc1c(F)cnc(C(F)F)c1F |
| InChI | InChI=1S/C6H4F4N2/c7-2-1-12-5(6(9)10)3(8)4(2)11/h1,6H,(H2,11,12) |
| InChIKey | JTKXFPQPDAWEMO-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.10 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |