C7H4F5IN2 — CID 118812353
2-(difluoromethyl)-3-iodo-5-(trifluoromethyl)pyridin-4-amine (PubChem CID 118812353) has the molecular formula C7H4F5IN2 and a molecular weight of 338.02 g/mol. Its IUPAC name is 2-(difluoromethyl)-3-iodo-5-(trifluoromethyl)pyridin-4-amine.
| Compound Name | 2-(difluoromethyl)-3-iodo-5-(trifluoromethyl)pyridin-4-amine |
|---|---|
| PubChem CID | 118812353 |
| Molecular Formula | C7H4F5IN2 |
| Molecular Weight | 338.02 g/mol |
| Exact Mass | 337.93 |
| IUPAC Name | 2-(difluoromethyl)-3-iodo-5-(trifluoromethyl)pyridin-4-amine |
| SMILES | Nc1c(C(F)(F)F)cnc(C(F)F)c1I |
| InChI | InChI=1S/C7H4F5IN2/c8-6(9)5-3(13)4(14)2(1-15-5)7(10,11)12/h1,6H,(H2,14,15) |
| InChIKey | UKVVIZBGTGUUFZ-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.02 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|