C17H20N2O2 — CID 11881249
(3aS,4S,7aS)-4-methyl-2-[(3-methylanilino)methyl]-3a,4,7,7a-tetrahydroisoindole-1,3-dione (PubChem CID 11881249) has the molecular formula C17H20N2O2 and a molecular weight of 284.36 g/mol. Its IUPAC name is (3aS,4S,7aS)-4-methyl-2-[(3-methylanilino)methyl]-3a,4,7,7a-tetrahydroisoindole-1,3-dione.
| Compound Name | (3aS,4S,7aS)-4-methyl-2-[(3-methylanilino)methyl]-3a,4,7,7a-tetrahydroisoindole-1,3-dione |
|---|---|
| PubChem CID | 11881249 |
| Molecular Formula | C17H20N2O2 |
| Molecular Weight | 284.36 g/mol |
| Exact Mass | 284.15 |
| IUPAC Name | (3aS,4S,7aS)-4-methyl-2-[(3-methylanilino)methyl]-3a,4,7,7a-tetrahydroisoindole-1,3-dione |
| SMILES | Cc1cccc(NCN2C(=O)[C@@H]3[C@H](CC=C[C@@H]3C)C2=O)c1 |
| InChI | InChI=1S/C17H20N2O2/c1-11-5-3-7-13(9-11)18-10-19-16(20)14-8-4-6-12(2)15(14)17(19)21/h3-7,9,12,14-15,18H,8,10H2,1-2H3/t12-,14-,15-/m0/s1 |
| InChIKey | CEICMGQIUJGADA-QEJZJMRPSA-N |
| XLogP | 2.56 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.36 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|