C12H6Cl3NO2 — CID 118813611
2-(2,4,5-trichlorophenyl)pyridine-3-carboxylic acid (PubChem CID 118813611) has the molecular formula C12H6Cl3NO2 and a molecular weight of 302.54 g/mol. Its IUPAC name is 2-(2,4,5-trichlorophenyl)pyridine-3-carboxylic acid.
| Compound Name | 2-(2,4,5-trichlorophenyl)pyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 118813611 |
| Molecular Formula | C12H6Cl3NO2 |
| Molecular Weight | 302.54 g/mol |
| Exact Mass | 300.95 |
| IUPAC Name | 2-(2,4,5-trichlorophenyl)pyridine-3-carboxylic acid |
| SMILES | O=C(O)c1cccnc1-c1cc(Cl)c(Cl)cc1Cl |
| InChI | InChI=1S/C12H6Cl3NO2/c13-8-5-10(15)9(14)4-7(8)11-6(12(17)18)2-1-3-16-11/h1-5H,(H,17,18) |
| InChIKey | UFJPQBMKKCVGFA-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.54 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|