C9H5Cl3N2O2S2 — CID 118813692
2-(2,3,4-trichlorophenyl)-1,3-thiazole-5-sulfonamide (PubChem CID 118813692) has the molecular formula C9H5Cl3N2O2S2 and a molecular weight of 343.64 g/mol. Its IUPAC name is 2-(2,3,4-trichlorophenyl)-1,3-thiazole-5-sulfonamide.
| Compound Name | 2-(2,3,4-trichlorophenyl)-1,3-thiazole-5-sulfonamide |
|---|---|
| PubChem CID | 118813692 |
| Molecular Formula | C9H5Cl3N2O2S2 |
| Molecular Weight | 343.64 g/mol |
| Exact Mass | 341.89 |
| IUPAC Name | 2-(2,3,4-trichlorophenyl)-1,3-thiazole-5-sulfonamide |
| SMILES | NS(=O)(=O)c1cnc(-c2ccc(Cl)c(Cl)c2Cl)s1 |
| InChI | InChI=1S/C9H5Cl3N2O2S2/c10-5-2-1-4(7(11)8(5)12)9-14-3-6(17-9)18(13,15)16/h1-3H,(H2,13,15,16) |
| InChIKey | RUKWIJUPZZSOGD-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 73.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.64 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|