C17H30NO3+ — CID 11881489
[(1R,2S,6R)-2,4,6-trimethylcyclohex-3-en-1-yl]methyl 2-(4-methylmorpholin-4-ium-4-yl)acetate (PubChem CID 11881489) has the molecular formula C17H30NO3+ and a molecular weight of 296.43 g/mol. Its IUPAC name is [(1R,2S,6R)-2,4,6-trimethylcyclohex-3-en-1-yl]methyl 2-(4-methylmorpholin-4-ium-4-yl)acetate.
| Compound Name | [(1R,2S,6R)-2,4,6-trimethylcyclohex-3-en-1-yl]methyl 2-(4-methylmorpholin-4-ium-4-yl)acetate |
|---|---|
| PubChem CID | 11881489 |
| Molecular Formula | C17H30NO3+ |
| Molecular Weight | 296.43 g/mol |
| Exact Mass | 296.22 |
| IUPAC Name | [(1R,2S,6R)-2,4,6-trimethylcyclohex-3-en-1-yl]methyl 2-(4-methylmorpholin-4-ium-4-yl)acetate |
| SMILES | CC1=C[C@H](C)[C@H](COC(=O)C[N+]2(C)CCOCC2)[C@H](C)C1 |
| InChI | InChI=1S/C17H30NO3/c1-13-9-14(2)16(15(3)10-13)12-21-17(19)11-18(4)5-7-20-8-6-18/h9,14-16H,5-8,10-12H2,1-4H3/q+1/t14-,15+,16-/m0/s1 |
| InChIKey | IQEPDWNNDXWUOP-XHSDSOJGSA-N |
| XLogP | 2.24 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.43 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|