C7H4F3NO2 — CID 118815134
2-(difluoromethyl)-6-fluoropyridine-3-carboxylic acid (PubChem CID 118815134) has the molecular formula C7H4F3NO2 and a molecular weight of 191.11 g/mol. Its IUPAC name is 2-(difluoromethyl)-6-fluoropyridine-3-carboxylic acid.
| Compound Name | 2-(difluoromethyl)-6-fluoropyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 118815134 |
| Molecular Formula | C7H4F3NO2 |
| Molecular Weight | 191.11 g/mol |
| Exact Mass | 191.02 |
| IUPAC Name | 2-(difluoromethyl)-6-fluoropyridine-3-carboxylic acid |
| SMILES | O=C(O)c1ccc(F)nc1C(F)F |
| InChI | InChI=1S/C7H4F3NO2/c8-4-2-1-3(7(12)13)5(11-4)6(9)10/h1-2,6H,(H,12,13) |
| InChIKey | FIXDPTABBQULIA-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.11 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|