C11H13BrOS2 — CID 118815386
1-[2,6-bis(methylsulfanyl)phenyl]-3-bromopropan-2-one (PubChem CID 118815386) has the molecular formula C11H13BrOS2 and a molecular weight of 305.26 g/mol. Its IUPAC name is 1-[2,6-bis(methylsulfanyl)phenyl]-3-bromopropan-2-one.
| Compound Name | 1-[2,6-bis(methylsulfanyl)phenyl]-3-bromopropan-2-one |
|---|---|
| PubChem CID | 118815386 |
| Molecular Formula | C11H13BrOS2 |
| Molecular Weight | 305.26 g/mol |
| Exact Mass | 303.96 |
| IUPAC Name | 1-[2,6-bis(methylsulfanyl)phenyl]-3-bromopropan-2-one |
| SMILES | CSc1cccc(SC)c1CC(=O)CBr |
| InChI | InChI=1S/C11H13BrOS2/c1-14-10-4-3-5-11(15-2)9(10)6-8(13)7-12/h3-5H,6-7H2,1-2H3 |
| InChIKey | LQCJLISPAMCSHH-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.26 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|