About 2-fluoro-1,3-benzoxazole-4-carbonitrile
2-fluoro-1,3-benzoxazole-4-carbonitrile (PubChem CID 118816361) has the molecular formula C8H3FN2O
and a molecular weight of 162.12 g/mol. Its IUPAC name is 2-fluoro-1,3-benzoxazole-4-carbonitrile.
Molecular Properties
| Compound Name | 2-fluoro-1,3-benzoxazole-4-carbonitrile |
| PubChem CID | 118816361 |
| Molecular Formula | C8H3FN2O |
| Molecular Weight | 162.12 g/mol |
| Exact Mass | 162.02 |
| IUPAC Name | 2-fluoro-1,3-benzoxazole-4-carbonitrile |
| SMILES | N#Cc1cccc2oc(F)nc12 |
| InChI | InChI=1S/C8H3FN2O/c9-8-11-7-5(4-10)2-1-3-6(7)12-8/h1-3H |
| InChIKey | MLPWERJZUPSPHR-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 49.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 162.12 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-fluoro-1,3-benzoxazole-4-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-fluoro-1,3-benzoxazole-4-carbonitrile?
The IUPAC name of 2-fluoro-1,3-benzoxazole-4-carbonitrile (CID 118816361) is 2-fluoro-1,3-benzoxazole-4-carbonitrile.
What is the SMILES notation for 2-fluoro-1,3-benzoxazole-4-carbonitrile?
The canonical SMILES for 2-fluoro-1,3-benzoxazole-4-carbonitrile is N#Cc1cccc2oc(F)nc12.
What is the InChIKey of 2-fluoro-1,3-benzoxazole-4-carbonitrile?
The InChIKey is MLPWERJZUPSPHR-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H3FN2O/c9-8-11-7-5(4-10)2-1-3-6(7)12-8/h1-3H.
What are the key properties of 2-fluoro-1,3-benzoxazole-4-carbonitrile?
2-fluoro-1,3-benzoxazole-4-carbonitrile has a molecular weight of 162.12 g/mol, XLogP of 1.84, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-fluoro-1,3-benzoxazole-4-carbonitrile is sourced from PubChem (CID 118816361), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).