C14H8Cl2FN — CID 118818713
2-[2-(2,4-dichlorophenyl)-6-fluorophenyl]acetonitrile (PubChem CID 118818713) has the molecular formula C14H8Cl2FN and a molecular weight of 280.13 g/mol. Its IUPAC name is 2-[2-(2,4-dichlorophenyl)-6-fluorophenyl]acetonitrile.
| Compound Name | 2-[2-(2,4-dichlorophenyl)-6-fluorophenyl]acetonitrile |
|---|---|
| PubChem CID | 118818713 |
| Molecular Formula | C14H8Cl2FN |
| Molecular Weight | 280.13 g/mol |
| Exact Mass | 279.00 |
| IUPAC Name | 2-[2-(2,4-dichlorophenyl)-6-fluorophenyl]acetonitrile |
| SMILES | N#CCc1c(F)cccc1-c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C14H8Cl2FN/c15-9-4-5-11(13(16)8-9)10-2-1-3-14(17)12(10)6-7-18/h1-5,8H,6H2 |
| InChIKey | STCBHHXCMWYBSN-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.13 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |