C15H25N2O2+ — CID 11881886
3-[(3aR,4R,7aR)-4,6-dimethyl-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]propyl-dimethylazanium (PubChem CID 11881886) has the molecular formula C15H25N2O2+ and a molecular weight of 265.38 g/mol. Its IUPAC name is 3-[(3aR,4R,7aR)-4,6-dimethyl-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]propyl-dimethylazanium.
| Compound Name | 3-[(3aR,4R,7aR)-4,6-dimethyl-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]propyl-dimethylazanium |
|---|---|
| PubChem CID | 11881886 |
| Molecular Formula | C15H25N2O2+ |
| Molecular Weight | 265.38 g/mol |
| Exact Mass | 265.19 |
| IUPAC Name | 3-[(3aR,4R,7aR)-4,6-dimethyl-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]propyl-dimethylazanium |
| SMILES | CC1=C[C@@H](C)[C@H]2C(=O)N(CCC[NH+](C)C)C(=O)[C@@H]2C1 |
| InChI | InChI=1S/C15H24N2O2/c1-10-8-11(2)13-12(9-10)14(18)17(15(13)19)7-5-6-16(3)4/h8,11-13H,5-7,9H2,1-4H3/p+1/t11-,12-,13-/m1/s1 |
| InChIKey | OLVIZFKZLFJCGX-JHJVBQTASA-O |
| XLogP | 0.11 |
| TPSA | 41.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.38 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|