C17H10F4 — CID 118819191
1-fluoro-3-[3-(trifluoromethyl)phenyl]naphthalene (PubChem CID 118819191) has the molecular formula C17H10F4 and a molecular weight of 290.26 g/mol. Its IUPAC name is 1-fluoro-3-[3-(trifluoromethyl)phenyl]naphthalene.
| Compound Name | 1-fluoro-3-[3-(trifluoromethyl)phenyl]naphthalene |
|---|---|
| PubChem CID | 118819191 |
| Molecular Formula | C17H10F4 |
| Molecular Weight | 290.26 g/mol |
| Exact Mass | 290.07 |
| IUPAC Name | 1-fluoro-3-[3-(trifluoromethyl)phenyl]naphthalene |
| SMILES | Fc1cc(-c2cccc(C(F)(F)F)c2)cc2ccccc12 |
| InChI | InChI=1S/C17H10F4/c18-16-10-13(8-12-4-1-2-7-15(12)16)11-5-3-6-14(9-11)17(19,20)21/h1-10H |
| InChIKey | MQGSSZFHSKGBCG-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.26 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |