C11H10ClF5O — CID 118819842
2-(3-chloropropyl)-1-(difluoromethoxy)-3-(trifluoromethyl)benzene (PubChem CID 118819842) has the molecular formula C11H10ClF5O and a molecular weight of 288.64 g/mol. Its IUPAC name is 2-(3-chloropropyl)-1-(difluoromethoxy)-3-(trifluoromethyl)benzene.
| Compound Name | 2-(3-chloropropyl)-1-(difluoromethoxy)-3-(trifluoromethyl)benzene |
|---|---|
| PubChem CID | 118819842 |
| Molecular Formula | C11H10ClF5O |
| Molecular Weight | 288.64 g/mol |
| Exact Mass | 288.03 |
| IUPAC Name | 2-(3-chloropropyl)-1-(difluoromethoxy)-3-(trifluoromethyl)benzene |
| SMILES | FC(F)Oc1cccc(C(F)(F)F)c1CCCCl |
| InChI | InChI=1S/C11H10ClF5O/c12-6-2-3-7-8(11(15,16)17)4-1-5-9(7)18-10(13)14/h1,4-5,10H,2-3,6H2 |
| InChIKey | AWFLTXZQWRYXOV-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.64 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|