5-hydroxy-2-nitrobenzoic acid

C7H5NO5 — CID 11882

IUPAC5-hydroxy-2-nitrobenzoic acid
SMILESO=C(O)c1cc(O)ccc1[N+](=O)[O-]
InChIInChI=1S/C7H5NO5/c9-4-1-2-6(8(12)13)5(3-4)7(10)11/h1-3,9H,(H,10,11)
InChIKeyBUHKQTKKZAXSMH-UHFFFAOYSA-N
MW183.12 g/mol
LogP1.00
Rot. Bonds2

About 5-hydroxy-2-nitrobenzoic acid

5-hydroxy-2-nitrobenzoic acid (PubChem CID 11882) has the molecular formula C7H5NO5 and a molecular weight of 183.12 g/mol. Its IUPAC name is 5-hydroxy-2-nitrobenzoic acid.

Molecular Properties

Compound Name5-hydroxy-2-nitrobenzoic acid
PubChem CID11882
Molecular FormulaC7H5NO5
Molecular Weight183.12 g/mol
Exact Mass183.02
IUPAC Name5-hydroxy-2-nitrobenzoic acid
SMILESO=C(O)c1cc(O)ccc1[N+](=O)[O-]
InChIInChI=1S/C7H5NO5/c9-4-1-2-6(8(12)13)5(3-4)7(10)11/h1-3,9H,(H,10,11)
InChIKeyBUHKQTKKZAXSMH-UHFFFAOYSA-N
XLogP1.00
TPSA100.67 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds2
Heavy Atoms13
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500183.12
LogP ≤ 51.00
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}

Analyze 5-hydroxy-2-nitrobenzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 5-hydroxy-2-nitrobenzoic acid?
The IUPAC name of 5-hydroxy-2-nitrobenzoic acid (CID 11882) is 5-hydroxy-2-nitrobenzoic acid.
What is the SMILES notation for 5-hydroxy-2-nitrobenzoic acid?
The canonical SMILES for 5-hydroxy-2-nitrobenzoic acid is O=C(O)c1cc(O)ccc1[N+](=O)[O-].
What is the InChIKey of 5-hydroxy-2-nitrobenzoic acid?
The InChIKey is BUHKQTKKZAXSMH-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H5NO5/c9-4-1-2-6(8(12)13)5(3-4)7(10)11/h1-3,9H,(H,10,11).
What are the key properties of 5-hydroxy-2-nitrobenzoic acid?
5-hydroxy-2-nitrobenzoic acid has a molecular weight of 183.12 g/mol, XLogP of 1.00, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-hydroxy-2-nitrobenzoic acid is sourced from PubChem (CID 11882), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).