C7H6F2N2O3 — CID 118820480
2-(difluoromethyl)-3-hydroxy-6-oxo-1H-pyridine-4-carboxamide (PubChem CID 118820480) has the molecular formula C7H6F2N2O3 and a molecular weight of 204.13 g/mol. Its IUPAC name is 2-(difluoromethyl)-3-hydroxy-6-oxo-1H-pyridine-4-carboxamide.
| Compound Name | 2-(difluoromethyl)-3-hydroxy-6-oxo-1H-pyridine-4-carboxamide |
|---|---|
| PubChem CID | 118820480 |
| Molecular Formula | C7H6F2N2O3 |
| Molecular Weight | 204.13 g/mol |
| Exact Mass | 204.03 |
| IUPAC Name | 2-(difluoromethyl)-3-hydroxy-6-oxo-1H-pyridine-4-carboxamide |
| SMILES | NC(=O)c1cc(=O)[nH]c(C(F)F)c1O |
| InChI | InChI=1S/C7H6F2N2O3/c8-6(9)4-5(13)2(7(10)14)1-3(12)11-4/h1,6,13H,(H2,10,14)(H,11,12) |
| InChIKey | JWXHKOXGKHOEEW-UHFFFAOYSA-N |
| XLogP | 0.12 |
| TPSA | 96.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.13 |
| LogP ≤ 5 | 0.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |