C15H7F7O2 — CID 118820898
methyl 2,3,5,6-tetrafluoro-4-[3-(trifluoromethyl)phenyl]benzoate (PubChem CID 118820898) has the molecular formula C15H7F7O2 and a molecular weight of 352.21 g/mol. Its IUPAC name is methyl 2,3,5,6-tetrafluoro-4-[3-(trifluoromethyl)phenyl]benzoate.
| Compound Name | methyl 2,3,5,6-tetrafluoro-4-[3-(trifluoromethyl)phenyl]benzoate |
|---|---|
| PubChem CID | 118820898 |
| Molecular Formula | C15H7F7O2 |
| Molecular Weight | 352.21 g/mol |
| Exact Mass | 352.03 |
| IUPAC Name | methyl 2,3,5,6-tetrafluoro-4-[3-(trifluoromethyl)phenyl]benzoate |
| SMILES | COC(=O)c1c(F)c(F)c(-c2cccc(C(F)(F)F)c2)c(F)c1F |
| InChI | InChI=1S/C15H7F7O2/c1-24-14(23)9-12(18)10(16)8(11(17)13(9)19)6-3-2-4-7(5-6)15(20,21)22/h2-5H,1H3 |
| InChIKey | AURBDQOMGWFERB-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.21 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|