C10H8ClF3N2O2 — CID 118821184
2-[2-(chloromethyl)-6-methoxy-3-(trifluoromethoxy)-4-pyridinyl]acetonitrile (PubChem CID 118821184) has the molecular formula C10H8ClF3N2O2 and a molecular weight of 280.63 g/mol. Its IUPAC name is 2-[2-(chloromethyl)-6-methoxy-3-(trifluoromethoxy)-4-pyridinyl]acetonitrile.
| Compound Name | 2-[2-(chloromethyl)-6-methoxy-3-(trifluoromethoxy)-4-pyridinyl]acetonitrile |
|---|---|
| PubChem CID | 118821184 |
| Molecular Formula | C10H8ClF3N2O2 |
| Molecular Weight | 280.63 g/mol |
| Exact Mass | 280.02 |
| IUPAC Name | 2-[2-(chloromethyl)-6-methoxy-3-(trifluoromethoxy)-4-pyridinyl]acetonitrile |
| SMILES | COc1cc(CC#N)c(OC(F)(F)F)c(CCl)n1 |
| InChI | InChI=1S/C10H8ClF3N2O2/c1-17-8-4-6(2-3-15)9(7(5-11)16-8)18-10(12,13)14/h4H,2,5H2,1H3 |
| InChIKey | NZZUKLYYCKGITD-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 55.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.63 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|