About 2-[4-methoxy-6-(2,4,6-trichlorophenyl)-1H-indol-3-yl]acetonitrile
2-[4-methoxy-6-(2,4,6-trichlorophenyl)-1H-indol-3-yl]acetonitrile (PubChem CID 118821897) has the molecular formula C17H11Cl3N2O
and a molecular weight of 365.65 g/mol. Its IUPAC name is 2-[4-methoxy-6-(2,4,6-trichlorophenyl)-1H-indol-3-yl]acetonitrile.
Molecular Properties
| Compound Name | 2-[4-methoxy-6-(2,4,6-trichlorophenyl)-1H-indol-3-yl]acetonitrile |
| PubChem CID | 118821897 |
| Molecular Formula | C17H11Cl3N2O |
| Molecular Weight | 365.65 g/mol |
| Exact Mass | 363.99 |
| IUPAC Name | 2-[4-methoxy-6-(2,4,6-trichlorophenyl)-1H-indol-3-yl]acetonitrile |
| SMILES | COc1cc(-c2c(Cl)cc(Cl)cc2Cl)cc2[nH]cc(CC#N)c12 |
| InChI | InChI=1S/C17H11Cl3N2O/c1-23-15-5-10(16-12(19)6-11(18)7-13(16)20)4-14-17(15)9(2-3-21)8-22-14/h4-8,22H,2H2,1H3 |
| InChIKey | CMUZVEPAZCAHJD-UHFFFAOYSA-N |
| XLogP | 5.87 |
| TPSA | 48.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 365.65 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-[4-methoxy-6-(2,4,6-trichlorophenyl)-1H-indol-3-yl]acetonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4-methoxy-6-(2,4,6-trichlorophenyl)-1H-indol-3-yl]acetonitrile?
The IUPAC name of 2-[4-methoxy-6-(2,4,6-trichlorophenyl)-1H-indol-3-yl]acetonitrile (CID 118821897) is 2-[4-methoxy-6-(2,4,6-trichlorophenyl)-1H-indol-3-yl]acetonitrile.
What is the SMILES notation for 2-[4-methoxy-6-(2,4,6-trichlorophenyl)-1H-indol-3-yl]acetonitrile?
The canonical SMILES for 2-[4-methoxy-6-(2,4,6-trichlorophenyl)-1H-indol-3-yl]acetonitrile is COc1cc(-c2c(Cl)cc(Cl)cc2Cl)cc2[nH]cc(CC#N)c12.
What is the InChIKey of 2-[4-methoxy-6-(2,4,6-trichlorophenyl)-1H-indol-3-yl]acetonitrile?
The InChIKey is CMUZVEPAZCAHJD-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H11Cl3N2O/c1-23-15-5-10(16-12(19)6-11(18)7-13(16)20)4-14-17(15)9(2-3-21)8-22-14/h4-8,22H,2H2,1H3.
What are the key properties of 2-[4-methoxy-6-(2,4,6-trichlorophenyl)-1H-indol-3-yl]acetonitrile?
2-[4-methoxy-6-(2,4,6-trichlorophenyl)-1H-indol-3-yl]acetonitrile has a molecular weight of 365.65 g/mol, XLogP of 5.87, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-methoxy-6-(2,4,6-trichlorophenyl)-1H-indol-3-yl]acetonitrile is sourced from PubChem (CID 118821897), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).