C10H20N+ — CID 11882265
[(2S,4aS,8aR)-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl]azanium (PubChem CID 11882265) has the molecular formula C10H20N+ and a molecular weight of 154.28 g/mol. Its IUPAC name is [(2S,4aS,8aR)-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl]azanium.
| Compound Name | [(2S,4aS,8aR)-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl]azanium |
|---|---|
| PubChem CID | 11882265 |
| Molecular Formula | C10H20N+ |
| Molecular Weight | 154.28 g/mol |
| Exact Mass | 154.16 |
| IUPAC Name | [(2S,4aS,8aR)-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl]azanium |
| SMILES | [NH3+][C@H]1CC[C@@H]2CCCC[C@@H]2C1 |
| InChI | InChI=1S/C10H19N/c11-10-6-5-8-3-1-2-4-9(8)7-10/h8-10H,1-7,11H2/p+1/t8-,9+,10-/m0/s1 |
| InChIKey | FFROQSBSJYRALS-AEJSXWLSSA-O |
| XLogP | 1.59 |
| TPSA | 27.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 154.28 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |