C7H4F6N2O — CID 118823425
3-(difluoromethyl)-2-fluoro-6-(trifluoromethoxy)pyridin-4-amine (PubChem CID 118823425) has the molecular formula C7H4F6N2O and a molecular weight of 246.11 g/mol. Its IUPAC name is 3-(difluoromethyl)-2-fluoro-6-(trifluoromethoxy)pyridin-4-amine.
| Compound Name | 3-(difluoromethyl)-2-fluoro-6-(trifluoromethoxy)pyridin-4-amine |
|---|---|
| PubChem CID | 118823425 |
| Molecular Formula | C7H4F6N2O |
| Molecular Weight | 246.11 g/mol |
| Exact Mass | 246.02 |
| IUPAC Name | 3-(difluoromethyl)-2-fluoro-6-(trifluoromethoxy)pyridin-4-amine |
| SMILES | Nc1cc(OC(F)(F)F)nc(F)c1C(F)F |
| InChI | InChI=1S/C7H4F6N2O/c8-5(9)4-2(14)1-3(15-6(4)10)16-7(11,12)13/h1,5H,(H2,14,15) |
| InChIKey | APHOMVNMUSUHLB-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 48.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.11 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|