About 2-[2-(2,3,4-trichlorophenyl)-3-(trifluoromethyl)-4-pyridinyl]acetonitrile
2-[2-(2,3,4-trichlorophenyl)-3-(trifluoromethyl)-4-pyridinyl]acetonitrile (PubChem CID 118824848) has the molecular formula C14H6Cl3F3N2
and a molecular weight of 365.57 g/mol. Its IUPAC name is 2-[2-(2,3,4-trichlorophenyl)-3-(trifluoromethyl)-4-pyridinyl]acetonitrile.
Molecular Properties
| Compound Name | 2-[2-(2,3,4-trichlorophenyl)-3-(trifluoromethyl)-4-pyridinyl]acetonitrile |
| PubChem CID | 118824848 |
| Molecular Formula | C14H6Cl3F3N2 |
| Molecular Weight | 365.57 g/mol |
| Exact Mass | 363.95 |
| IUPAC Name | 2-[2-(2,3,4-trichlorophenyl)-3-(trifluoromethyl)-4-pyridinyl]acetonitrile |
| SMILES | N#CCc1ccnc(-c2ccc(Cl)c(Cl)c2Cl)c1C(F)(F)F |
| InChI | InChI=1S/C14H6Cl3F3N2/c15-9-2-1-8(11(16)12(9)17)13-10(14(18,19)20)7(3-5-21)4-6-22-13/h1-2,4,6H,3H2 |
| InChIKey | PWWJHSLXKNDDJC-UHFFFAOYSA-N |
| XLogP | 5.79 |
| TPSA | 36.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 365.57 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|
Analyze 2-[2-(2,3,4-trichlorophenyl)-3-(trifluoromethyl)-4-pyridinyl]acetonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-(2,3,4-trichlorophenyl)-3-(trifluoromethyl)-4-pyridinyl]acetonitrile?
The IUPAC name of 2-[2-(2,3,4-trichlorophenyl)-3-(trifluoromethyl)-4-pyridinyl]acetonitrile (CID 118824848) is 2-[2-(2,3,4-trichlorophenyl)-3-(trifluoromethyl)-4-pyridinyl]acetonitrile.
What is the SMILES notation for 2-[2-(2,3,4-trichlorophenyl)-3-(trifluoromethyl)-4-pyridinyl]acetonitrile?
The canonical SMILES for 2-[2-(2,3,4-trichlorophenyl)-3-(trifluoromethyl)-4-pyridinyl]acetonitrile is N#CCc1ccnc(-c2ccc(Cl)c(Cl)c2Cl)c1C(F)(F)F.
What is the InChIKey of 2-[2-(2,3,4-trichlorophenyl)-3-(trifluoromethyl)-4-pyridinyl]acetonitrile?
The InChIKey is PWWJHSLXKNDDJC-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H6Cl3F3N2/c15-9-2-1-8(11(16)12(9)17)13-10(14(18,19)20)7(3-5-21)4-6-22-13/h1-2,4,6H,3H2.
What are the key properties of 2-[2-(2,3,4-trichlorophenyl)-3-(trifluoromethyl)-4-pyridinyl]acetonitrile?
2-[2-(2,3,4-trichlorophenyl)-3-(trifluoromethyl)-4-pyridinyl]acetonitrile has a molecular weight of 365.57 g/mol, XLogP of 5.79, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-(2,3,4-trichlorophenyl)-3-(trifluoromethyl)-4-pyridinyl]acetonitrile is sourced from PubChem (CID 118824848), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).