C13H5Cl3F3NO — CID 118824997
2-(3,4,5-trichlorophenyl)-3-(trifluoromethyl)pyridine-4-carbaldehyde (PubChem CID 118824997) has the molecular formula C13H5Cl3F3NO and a molecular weight of 354.54 g/mol. Its IUPAC name is 2-(3,4,5-trichlorophenyl)-3-(trifluoromethyl)pyridine-4-carbaldehyde.
| Compound Name | 2-(3,4,5-trichlorophenyl)-3-(trifluoromethyl)pyridine-4-carbaldehyde |
|---|---|
| PubChem CID | 118824997 |
| Molecular Formula | C13H5Cl3F3NO |
| Molecular Weight | 354.54 g/mol |
| Exact Mass | 352.94 |
| IUPAC Name | 2-(3,4,5-trichlorophenyl)-3-(trifluoromethyl)pyridine-4-carbaldehyde |
| SMILES | O=Cc1ccnc(-c2cc(Cl)c(Cl)c(Cl)c2)c1C(F)(F)F |
| InChI | InChI=1S/C13H5Cl3F3NO/c14-8-3-7(4-9(15)11(8)16)12-10(13(17,18)19)6(5-21)1-2-20-12/h1-5H |
| InChIKey | RVPAGDWOURZDEU-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.54 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|