C17H21F3N4O7 — CID 11882550
(1S,3R,4R,5S)-N-(2-amino-2-oxoethyl)-1,3,4-trihydroxy-5-[[4-(trifluoromethoxy)phenyl]carbamoylamino]cyclohexane-1-carboxamide (PubChem CID 11882550) has the molecular formula C17H21F3N4O7 and a molecular weight of 450.37 g/mol. Its IUPAC name is (1S,3R,4R,5S)-N-(2-amino-2-oxoethyl)-1,3,4-trihydroxy-5-[[4-(trifluoromethoxy)phenyl]carbamoylamino]cyclohexane-1-carboxamide.
| Compound Name | (1S,3R,4R,5S)-N-(2-amino-2-oxoethyl)-1,3,4-trihydroxy-5-[[4-(trifluoromethoxy)phenyl]carbamoylamino]cyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 11882550 |
| Molecular Formula | C17H21F3N4O7 |
| Molecular Weight | 450.37 g/mol |
| Exact Mass | 450.14 |
| IUPAC Name | (1S,3R,4R,5S)-N-(2-amino-2-oxoethyl)-1,3,4-trihydroxy-5-[[4-(trifluoromethoxy)phenyl]carbamoylamino]cyclohexane-1-carboxamide |
| SMILES | NC(=O)CNC(=O)[C@@]1(O)C[C@@H](O)[C@H](O)[C@@H](NC(=O)Nc2ccc(OC(F)(F)F)cc2)C1 |
| InChI | InChI=1S/C17H21F3N4O7/c18-17(19,20)31-9-3-1-8(2-4-9)23-15(29)24-10-5-16(30,6-11(25)13(10)27)14(28)22-7-12(21)26/h1-4,10-11,13,25,27,30H,5-7H2,(H2,21,26)(H,22,28)(H2,23,24,29)/t10-,11+,13+,16-/m0/s1 |
| InChIKey | CYRAFCIXVLYVRT-IQDSPRDJSA-N |
| XLogP | -1.08 |
| TPSA | 183.24 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.37 |
| LogP ≤ 5 | -1.08 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |