C21H35N4O6S+ — CID 11882555
[(2S)-1-[[(1S,2R,3R,5S)-5-[[(2S)-1-amino-1-oxo-3-thiophen-2-ylpropan-2-yl]carbamoyl]-2,3,5-trihydroxycyclohexyl]amino]-4-methyl-1-oxopentan-2-yl]-methylazanium (PubChem CID 11882555) has the molecular formula C21H35N4O6S+ and a molecular weight of 471.60 g/mol. Its IUPAC name is [(2S)-1-[[(1S,2R,3R,5S)-5-[[(2S)-1-amino-1-oxo-3-thiophen-2-ylpropan-2-yl]carbamoyl]-2,3,5-trihydroxycyclohexyl]amino]-4-methyl-1-oxopentan-2-yl]-methylazanium.
| Compound Name | [(2S)-1-[[(1S,2R,3R,5S)-5-[[(2S)-1-amino-1-oxo-3-thiophen-2-ylpropan-2-yl]carbamoyl]-2,3,5-trihydroxycyclohexyl]amino]-4-methyl-1-oxopentan-2-yl]-methylazanium |
|---|---|
| PubChem CID | 11882555 |
| Molecular Formula | C21H35N4O6S+ |
| Molecular Weight | 471.60 g/mol |
| Exact Mass | 471.23 |
| IUPAC Name | [(2S)-1-[[(1S,2R,3R,5S)-5-[[(2S)-1-amino-1-oxo-3-thiophen-2-ylpropan-2-yl]carbamoyl]-2,3,5-trihydroxycyclohexyl]amino]-4-methyl-1-oxopentan-2-yl]-methylazanium |
| SMILES | C[NH2+][C@@H](CC(C)C)C(=O)N[C@H]1C[C@@](O)(C(=O)N[C@@H](Cc2cccs2)C(N)=O)C[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C21H34N4O6S/c1-11(2)7-14(23-3)19(29)24-15-9-21(31,10-16(26)17(15)27)20(30)25-13(18(22)28)8-12-5-4-6-32-12/h4-6,11,13-17,23,26-27,31H,7-10H2,1-3H3,(H2,22,28)(H,24,29)(H,25,30)/p+1/t13-,14-,15-,16+,17+,21-/m0/s1 |
| InChIKey | AQLPEQFOUHMVMF-MISPRECSSA-O |
| XLogP | -2.40 |
| TPSA | 178.59 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.60 |
| LogP ≤ 5 | -2.40 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |