C25H32N4O7 — CID 11882569
(1S,3R,4R,5S)-N-[(2S)-1-amino-3-(4-methoxyphenyl)-1-oxopropan-2-yl]-1,3,4-trihydroxy-5-[(4-methylphenyl)carbamoylamino]cyclohexane-1-carboxamide (PubChem CID 11882569) has the molecular formula C25H32N4O7 and a molecular weight of 500.55 g/mol. Its IUPAC name is (1S,3R,4R,5S)-N-[(2S)-1-amino-3-(4-methoxyphenyl)-1-oxopropan-2-yl]-1,3,4-trihydroxy-5-[(4-methylphenyl)carbamoylamino]cyclohexane-1-carboxamide.
| Compound Name | (1S,3R,4R,5S)-N-[(2S)-1-amino-3-(4-methoxyphenyl)-1-oxopropan-2-yl]-1,3,4-trihydroxy-5-[(4-methylphenyl)carbamoylamino]cyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 11882569 |
| Molecular Formula | C25H32N4O7 |
| Molecular Weight | 500.55 g/mol |
| Exact Mass | 500.23 |
| IUPAC Name | (1S,3R,4R,5S)-N-[(2S)-1-amino-3-(4-methoxyphenyl)-1-oxopropan-2-yl]-1,3,4-trihydroxy-5-[(4-methylphenyl)carbamoylamino]cyclohexane-1-carboxamide |
| SMILES | COc1ccc(C[C@H](NC(=O)[C@@]2(O)C[C@@H](O)[C@H](O)[C@@H](NC(=O)Nc3ccc(C)cc3)C2)C(N)=O)cc1 |
| InChI | InChI=1S/C25H32N4O7/c1-14-3-7-16(8-4-14)27-24(34)29-19-12-25(35,13-20(30)21(19)31)23(33)28-18(22(26)32)11-15-5-9-17(36-2)10-6-15/h3-10,18-21,30-31,35H,11-13H2,1-2H3,(H2,26,32)(H,28,33)(H2,27,29,34)/t18-,19-,20+,21+,25-/m0/s1 |
| InChIKey | ZSBZJMAHKZJPSX-JJQOCIJLSA-N |
| XLogP | -0.05 |
| TPSA | 183.24 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.55 |
| LogP ≤ 5 | -0.05 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |