C24H30N4O7 — CID 11882575
(1S,3R,4R,5S)-N-[(2S)-1-amino-3-(4-hydroxyphenyl)-1-oxopropan-2-yl]-1,3,4-trihydroxy-5-[(4-methylphenyl)carbamoylamino]cyclohexane-1-carboxamide (PubChem CID 11882575) has the molecular formula C24H30N4O7 and a molecular weight of 486.53 g/mol. Its IUPAC name is (1S,3R,4R,5S)-N-[(2S)-1-amino-3-(4-hydroxyphenyl)-1-oxopropan-2-yl]-1,3,4-trihydroxy-5-[(4-methylphenyl)carbamoylamino]cyclohexane-1-carboxamide.
| Compound Name | (1S,3R,4R,5S)-N-[(2S)-1-amino-3-(4-hydroxyphenyl)-1-oxopropan-2-yl]-1,3,4-trihydroxy-5-[(4-methylphenyl)carbamoylamino]cyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 11882575 |
| Molecular Formula | C24H30N4O7 |
| Molecular Weight | 486.53 g/mol |
| Exact Mass | 486.21 |
| IUPAC Name | (1S,3R,4R,5S)-N-[(2S)-1-amino-3-(4-hydroxyphenyl)-1-oxopropan-2-yl]-1,3,4-trihydroxy-5-[(4-methylphenyl)carbamoylamino]cyclohexane-1-carboxamide |
| SMILES | Cc1ccc(NC(=O)N[C@H]2C[C@@](O)(C(=O)N[C@@H](Cc3ccc(O)cc3)C(N)=O)C[C@@H](O)[C@@H]2O)cc1 |
| InChI | InChI=1S/C24H30N4O7/c1-13-2-6-15(7-3-13)26-23(34)28-18-11-24(35,12-19(30)20(18)31)22(33)27-17(21(25)32)10-14-4-8-16(29)9-5-14/h2-9,17-20,29-31,35H,10-12H2,1H3,(H2,25,32)(H,27,33)(H2,26,28,34)/t17-,18-,19+,20+,24-/m0/s1 |
| InChIKey | CNMMITYKYLSNIE-MAEPKYQWSA-N |
| XLogP | -0.35 |
| TPSA | 194.24 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.53 |
| LogP ≤ 5 | -0.35 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 7 |