C12H2F8 — CID 118826499
1,2,3,4,5-pentafluoro-6-(3,4,5-trifluorophenyl)benzene (PubChem CID 118826499) has the molecular formula C12H2F8 and a molecular weight of 298.13 g/mol. Its IUPAC name is 1,2,3,4,5-pentafluoro-6-(3,4,5-trifluorophenyl)benzene.
| Compound Name | 1,2,3,4,5-pentafluoro-6-(3,4,5-trifluorophenyl)benzene |
|---|---|
| PubChem CID | 118826499 |
| Molecular Formula | C12H2F8 |
| Molecular Weight | 298.13 g/mol |
| Exact Mass | 298.00 |
| IUPAC Name | 1,2,3,4,5-pentafluoro-6-(3,4,5-trifluorophenyl)benzene |
| SMILES | Fc1cc(-c2c(F)c(F)c(F)c(F)c2F)cc(F)c1F |
| InChI | InChI=1S/C12H2F8/c13-4-1-3(2-5(14)7(4)15)6-8(16)10(18)12(20)11(19)9(6)17/h1-2H |
| InChIKey | QMXFQQSAQZHRPX-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.13 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|