About 2-(cyanomethyl)-1,3-benzoxazole-5-sulfonyl chloride
2-(cyanomethyl)-1,3-benzoxazole-5-sulfonyl chloride (PubChem CID 118826604) has the molecular formula C9H5ClN2O3S
and a molecular weight of 256.67 g/mol. Its IUPAC name is 2-(cyanomethyl)-1,3-benzoxazole-5-sulfonyl chloride.
Molecular Properties
| Compound Name | 2-(cyanomethyl)-1,3-benzoxazole-5-sulfonyl chloride |
| PubChem CID | 118826604 |
| Molecular Formula | C9H5ClN2O3S |
| Molecular Weight | 256.67 g/mol |
| Exact Mass | 255.97 |
| IUPAC Name | 2-(cyanomethyl)-1,3-benzoxazole-5-sulfonyl chloride |
| SMILES | N#CCc1nc2cc(S(=O)(=O)Cl)ccc2o1 |
| InChI | InChI=1S/C9H5ClN2O3S/c10-16(13,14)6-1-2-8-7(5-6)12-9(15-8)3-4-11/h1-2,5H,3H2 |
| InChIKey | XYQSJQVTCZGOAW-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 83.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.67 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-(cyanomethyl)-1,3-benzoxazole-5-sulfonyl chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(cyanomethyl)-1,3-benzoxazole-5-sulfonyl chloride?
The IUPAC name of 2-(cyanomethyl)-1,3-benzoxazole-5-sulfonyl chloride (CID 118826604) is 2-(cyanomethyl)-1,3-benzoxazole-5-sulfonyl chloride.
What is the SMILES notation for 2-(cyanomethyl)-1,3-benzoxazole-5-sulfonyl chloride?
The canonical SMILES for 2-(cyanomethyl)-1,3-benzoxazole-5-sulfonyl chloride is N#CCc1nc2cc(S(=O)(=O)Cl)ccc2o1.
What is the InChIKey of 2-(cyanomethyl)-1,3-benzoxazole-5-sulfonyl chloride?
The InChIKey is XYQSJQVTCZGOAW-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H5ClN2O3S/c10-16(13,14)6-1-2-8-7(5-6)12-9(15-8)3-4-11/h1-2,5H,3H2.
What are the key properties of 2-(cyanomethyl)-1,3-benzoxazole-5-sulfonyl chloride?
2-(cyanomethyl)-1,3-benzoxazole-5-sulfonyl chloride has a molecular weight of 256.67 g/mol, XLogP of 1.82, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(cyanomethyl)-1,3-benzoxazole-5-sulfonyl chloride is sourced from PubChem (CID 118826604), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).