C9H7BrF2N2O — CID 118826974
2-(bromomethyl)-6-(difluoromethyl)-5-(hydroxymethyl)pyridine-3-carbonitrile (PubChem CID 118826974) has the molecular formula C9H7BrF2N2O and a molecular weight of 277.07 g/mol. Its IUPAC name is 2-(bromomethyl)-6-(difluoromethyl)-5-(hydroxymethyl)pyridine-3-carbonitrile.
| Compound Name | 2-(bromomethyl)-6-(difluoromethyl)-5-(hydroxymethyl)pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 118826974 |
| Molecular Formula | C9H7BrF2N2O |
| Molecular Weight | 277.07 g/mol |
| Exact Mass | 275.97 |
| IUPAC Name | 2-(bromomethyl)-6-(difluoromethyl)-5-(hydroxymethyl)pyridine-3-carbonitrile |
| SMILES | N#Cc1cc(CO)c(C(F)F)nc1CBr |
| InChI | InChI=1S/C9H7BrF2N2O/c10-2-7-5(3-13)1-6(4-15)8(14-7)9(11)12/h1,9,15H,2,4H2 |
| InChIKey | GKPWXZOPRJTFRY-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 56.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.07 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|