About 4-(chloromethyl)-2,6-dipyridin-4-ylpyridine
4-(chloromethyl)-2,6-dipyridin-4-ylpyridine (PubChem CID 118828222) has the molecular formula C16H12ClN3
and a molecular weight of 281.75 g/mol. Its IUPAC name is 4-(chloromethyl)-2,6-dipyridin-4-ylpyridine.
Molecular Properties
| Compound Name | 4-(chloromethyl)-2,6-dipyridin-4-ylpyridine |
| PubChem CID | 118828222 |
| Molecular Formula | C16H12ClN3 |
| Molecular Weight | 281.75 g/mol |
| Exact Mass | 281.07 |
| IUPAC Name | 4-(chloromethyl)-2,6-dipyridin-4-ylpyridine |
| SMILES | ClCc1cc(-c2ccncc2)nc(-c2ccncc2)c1 |
| InChI | InChI=1S/C16H12ClN3/c17-11-12-9-15(13-1-5-18-6-2-13)20-16(10-12)14-3-7-19-8-4-14/h1-10H,11H2 |
| InChIKey | WRQCVSUXFONPMF-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 281.75 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 4-(chloromethyl)-2,6-dipyridin-4-ylpyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(chloromethyl)-2,6-dipyridin-4-ylpyridine?
The IUPAC name of 4-(chloromethyl)-2,6-dipyridin-4-ylpyridine (CID 118828222) is 4-(chloromethyl)-2,6-dipyridin-4-ylpyridine.
What is the SMILES notation for 4-(chloromethyl)-2,6-dipyridin-4-ylpyridine?
The canonical SMILES for 4-(chloromethyl)-2,6-dipyridin-4-ylpyridine is ClCc1cc(-c2ccncc2)nc(-c2ccncc2)c1.
What is the InChIKey of 4-(chloromethyl)-2,6-dipyridin-4-ylpyridine?
The InChIKey is WRQCVSUXFONPMF-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H12ClN3/c17-11-12-9-15(13-1-5-18-6-2-13)20-16(10-12)14-3-7-19-8-4-14/h1-10H,11H2.
What are the key properties of 4-(chloromethyl)-2,6-dipyridin-4-ylpyridine?
4-(chloromethyl)-2,6-dipyridin-4-ylpyridine has a molecular weight of 281.75 g/mol, XLogP of 3.94, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(chloromethyl)-2,6-dipyridin-4-ylpyridine is sourced from PubChem (CID 118828222), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).