C13H8Cl2FNO2 — CID 118830681
2-[6-(2,6-dichlorophenyl)-5-fluoro-2-pyridinyl]acetic acid (PubChem CID 118830681) has the molecular formula C13H8Cl2FNO2 and a molecular weight of 300.12 g/mol. Its IUPAC name is 2-[6-(2,6-dichlorophenyl)-5-fluoro-2-pyridinyl]acetic acid.
| Compound Name | 2-[6-(2,6-dichlorophenyl)-5-fluoro-2-pyridinyl]acetic acid |
|---|---|
| PubChem CID | 118830681 |
| Molecular Formula | C13H8Cl2FNO2 |
| Molecular Weight | 300.12 g/mol |
| Exact Mass | 298.99 |
| IUPAC Name | 2-[6-(2,6-dichlorophenyl)-5-fluoro-2-pyridinyl]acetic acid |
| SMILES | O=C(O)Cc1ccc(F)c(-c2c(Cl)cccc2Cl)n1 |
| InChI | InChI=1S/C13H8Cl2FNO2/c14-8-2-1-3-9(15)12(8)13-10(16)5-4-7(17-13)6-11(18)19/h1-5H,6H2,(H,18,19) |
| InChIKey | KMYJUDBITSREOF-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.12 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |