C9H11F2NO2 — CID 118831655
[6-(difluoromethyl)-5-methoxy-2-methyl-3-pyridinyl]methanol (PubChem CID 118831655) has the molecular formula C9H11F2NO2 and a molecular weight of 203.19 g/mol. Its IUPAC name is [6-(difluoromethyl)-5-methoxy-2-methyl-3-pyridinyl]methanol.
| Compound Name | [6-(difluoromethyl)-5-methoxy-2-methyl-3-pyridinyl]methanol |
|---|---|
| PubChem CID | 118831655 |
| Molecular Formula | C9H11F2NO2 |
| Molecular Weight | 203.19 g/mol |
| Exact Mass | 203.08 |
| IUPAC Name | [6-(difluoromethyl)-5-methoxy-2-methyl-3-pyridinyl]methanol |
| SMILES | COc1cc(CO)c(C)nc1C(F)F |
| InChI | InChI=1S/C9H11F2NO2/c1-5-6(4-13)3-7(14-2)8(12-5)9(10)11/h3,9,13H,4H2,1-2H3 |
| InChIKey | MYPCJBKMAHEMII-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 42.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.19 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |