C15H25NO6 — CID 11883252
methyl 2-[[(3S,3aR,6R,6aS)-3-(2-ethylbutanoylamino)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]oxy]acetate (PubChem CID 11883252) has the molecular formula C15H25NO6 and a molecular weight of 315.37 g/mol. Its IUPAC name is methyl 2-[[(3S,3aR,6R,6aS)-3-(2-ethylbutanoylamino)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]oxy]acetate.
| Compound Name | methyl 2-[[(3S,3aR,6R,6aS)-3-(2-ethylbutanoylamino)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]oxy]acetate |
|---|---|
| PubChem CID | 11883252 |
| Molecular Formula | C15H25NO6 |
| Molecular Weight | 315.37 g/mol |
| Exact Mass | 315.17 |
| IUPAC Name | methyl 2-[[(3S,3aR,6R,6aS)-3-(2-ethylbutanoylamino)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]oxy]acetate |
| SMILES | CCC(CC)C(=O)N[C@H]1CO[C@H]2[C@@H]1OC[C@H]2OCC(=O)OC |
| InChI | InChI=1S/C15H25NO6/c1-4-9(5-2)15(18)16-10-6-21-14-11(7-22-13(10)14)20-8-12(17)19-3/h9-11,13-14H,4-8H2,1-3H3,(H,16,18)/t10-,11+,13+,14+/m0/s1 |
| InChIKey | GEOXIMOFAAGLKL-OIMNJJJWSA-N |
| XLogP | 0.26 |
| TPSA | 83.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.37 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |